C33H19F5N2O2 — CID 59838658
(2,3,4,5,6-pentafluorophenyl) 1-tritylindazole-3-carboxylate (PubChem CID 59838658) has the molecular formula C33H19F5N2O2 and a molecular weight of 570.52 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 1-tritylindazole-3-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 1-tritylindazole-3-carboxylate |
|---|---|
| PubChem CID | 59838658 |
| Molecular Formula | C33H19F5N2O2 |
| Molecular Weight | 570.52 g/mol |
| Exact Mass | 570.14 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 1-tritylindazole-3-carboxylate |
| SMILES | O=C(Oc1c(F)c(F)c(F)c(F)c1F)c1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C33H19F5N2O2/c34-25-26(35)28(37)31(29(38)27(25)36)42-32(41)30-23-18-10-11-19-24(23)40(39-30)33(20-12-4-1-5-13-20,21-14-6-2-7-15-21)22-16-8-3-9-17-22/h1-19H |
| InChIKey | IZGOUIMMJPICAF-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.52 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|