C31H24N4O — CID 159061475
2-(1H-pyrazol-4-yl)-1-(1-tritylindazol-3-yl)ethanone (PubChem CID 159061475) has the molecular formula C31H24N4O and a molecular weight of 468.56 g/mol. Its IUPAC name is 2-(1H-pyrazol-4-yl)-1-(1-tritylindazol-3-yl)ethanone.
| Compound Name | 2-(1H-pyrazol-4-yl)-1-(1-tritylindazol-3-yl)ethanone |
|---|---|
| PubChem CID | 159061475 |
| Molecular Formula | C31H24N4O |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 2-(1H-pyrazol-4-yl)-1-(1-tritylindazol-3-yl)ethanone |
| SMILES | O=C(Cc1cn[nH]c1)c1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C31H24N4O/c36-29(20-23-21-32-33-22-23)30-27-18-10-11-19-28(27)35(34-30)31(24-12-4-1-5-13-24,25-14-6-2-7-15-25)26-16-8-3-9-17-26/h1-19,21-22H,20H2,(H,32,33) |
| InChIKey | XUTPNHCMPRPBDR-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|