C26H15F5O3 — CID 89011726
(2,3,4,5,6-pentafluorophenyl) 4-[hydroxy(diphenyl)methyl]benzoate (PubChem CID 89011726) has the molecular formula C26H15F5O3 and a molecular weight of 470.39 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 4-[hydroxy(diphenyl)methyl]benzoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 4-[hydroxy(diphenyl)methyl]benzoate |
|---|---|
| PubChem CID | 89011726 |
| Molecular Formula | C26H15F5O3 |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 4-[hydroxy(diphenyl)methyl]benzoate |
| SMILES | O=C(Oc1c(F)c(F)c(F)c(F)c1F)c1ccc(C(O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H15F5O3/c27-19-20(28)22(30)24(23(31)21(19)29)34-25(32)15-11-13-18(14-12-15)26(33,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14,33H |
| InChIKey | NPWHBRIZOIWRGS-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|