C15H11F5O3 — CID 143222867
ethane;(2,3,4,5,6-pentafluorophenyl) 4-hydroxybenzoate (PubChem CID 143222867) has the molecular formula C15H11F5O3 and a molecular weight of 334.24 g/mol. Its IUPAC name is ethane;(2,3,4,5,6-pentafluorophenyl) 4-hydroxybenzoate.
| Compound Name | ethane;(2,3,4,5,6-pentafluorophenyl) 4-hydroxybenzoate |
|---|---|
| PubChem CID | 143222867 |
| Molecular Formula | C15H11F5O3 |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | ethane;(2,3,4,5,6-pentafluorophenyl) 4-hydroxybenzoate |
| SMILES | CC.O=C(Oc1c(F)c(F)c(F)c(F)c1F)c1ccc(O)cc1 |
| InChI | InChI=1S/C13H5F5O3.C2H6/c14-7-8(15)10(17)12(11(18)9(7)16)21-13(20)5-1-3-6(19)4-2-5;1-2/h1-4,19H;1-2H3 |
| InChIKey | LJFRPJHXNZWJHX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|