C14H6F5NO5 — CID 11660547
(2,3,4,5,6-pentafluorophenyl) 4-(nitrooxymethyl)benzoate (PubChem CID 11660547) has the molecular formula C14H6F5NO5 and a molecular weight of 363.19 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 4-(nitrooxymethyl)benzoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 4-(nitrooxymethyl)benzoate |
|---|---|
| PubChem CID | 11660547 |
| Molecular Formula | C14H6F5NO5 |
| Molecular Weight | 363.19 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 4-(nitrooxymethyl)benzoate |
| SMILES | O=C(Oc1c(F)c(F)c(F)c(F)c1F)c1ccc(CO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H6F5NO5/c15-8-9(16)11(18)13(12(19)10(8)17)25-14(21)7-3-1-6(2-4-7)5-24-20(22)23/h1-4H,5H2 |
| InChIKey | CEVHKUKYWJLAMM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.19 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|