C13H10F3O3P — CID 159509262
phosphane;(3,4,5-trifluorophenyl) 4-hydroxybenzoate (PubChem CID 159509262) has the molecular formula C13H10F3O3P and a molecular weight of 302.19 g/mol. Its IUPAC name is phosphane;(3,4,5-trifluorophenyl) 4-hydroxybenzoate.
| Compound Name | phosphane;(3,4,5-trifluorophenyl) 4-hydroxybenzoate |
|---|---|
| PubChem CID | 159509262 |
| Molecular Formula | C13H10F3O3P |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | phosphane;(3,4,5-trifluorophenyl) 4-hydroxybenzoate |
| SMILES | O=C(Oc1cc(F)c(F)c(F)c1)c1ccc(O)cc1.P |
| InChI | InChI=1S/C13H7F3O3.H3P/c14-10-5-9(6-11(15)12(10)16)19-13(18)7-1-3-8(17)4-2-7;/h1-6,17H;1H3 |
| InChIKey | UYRAKGSCMZBCOY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|