C28H17F5O4 — CID 145100529
(3,5-difluoro-4-methylphenyl) 4-[[4-(3,4,5-trifluorophenoxy)carbonylphenyl]methyl]benzoate (PubChem CID 145100529) has the molecular formula C28H17F5O4 and a molecular weight of 512.43 g/mol. Its IUPAC name is (3,5-difluoro-4-methylphenyl) 4-[[4-(3,4,5-trifluorophenoxy)carbonylphenyl]methyl]benzoate.
| Compound Name | (3,5-difluoro-4-methylphenyl) 4-[[4-(3,4,5-trifluorophenoxy)carbonylphenyl]methyl]benzoate |
|---|---|
| PubChem CID | 145100529 |
| Molecular Formula | C28H17F5O4 |
| Molecular Weight | 512.43 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | (3,5-difluoro-4-methylphenyl) 4-[[4-(3,4,5-trifluorophenoxy)carbonylphenyl]methyl]benzoate |
| SMILES | Cc1c(F)cc(OC(=O)c2ccc(Cc3ccc(C(=O)Oc4cc(F)c(F)c(F)c4)cc3)cc2)cc1F |
| InChI | InChI=1S/C28H17F5O4/c1-15-22(29)11-20(12-23(15)30)36-27(34)18-6-2-16(3-7-18)10-17-4-8-19(9-5-17)28(35)37-21-13-24(31)26(33)25(32)14-21/h2-9,11-14H,10H2,1H3 |
| InChIKey | NMORBVFNQLOOEY-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.43 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|