C35H32F5O4P — CID 130443680
(3,4,5-trifluorophenyl) 4-[9-[4-(3,5-difluoro-4-phosphanylphenoxy)carbonylphenyl]nonyl]benzoate (PubChem CID 130443680) has the molecular formula C35H32F5O4P and a molecular weight of 642.60 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl) 4-[9-[4-(3,5-difluoro-4-phosphanylphenoxy)carbonylphenyl]nonyl]benzoate.
| Compound Name | (3,4,5-trifluorophenyl) 4-[9-[4-(3,5-difluoro-4-phosphanylphenoxy)carbonylphenyl]nonyl]benzoate |
|---|---|
| PubChem CID | 130443680 |
| Molecular Formula | C35H32F5O4P |
| Molecular Weight | 642.60 g/mol |
| Exact Mass | 642.20 |
| IUPAC Name | (3,4,5-trifluorophenyl) 4-[9-[4-(3,5-difluoro-4-phosphanylphenoxy)carbonylphenyl]nonyl]benzoate |
| SMILES | O=C(Oc1cc(F)c(F)c(F)c1)c1ccc(CCCCCCCCCc2ccc(C(=O)Oc3cc(F)c(P)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C35H32F5O4P/c36-28-18-26(19-29(37)32(28)40)43-34(41)24-14-10-22(11-15-24)8-6-4-2-1-3-5-7-9-23-12-16-25(17-13-23)35(42)44-27-20-30(38)33(45)31(39)21-27/h10-21H,1-9,45H2 |
| InChIKey | MZXHZKHFBGYHIK-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.60 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|