C24H13F9O3 — CID 145124649
[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl] 4-(4,4-difluorobut-3-enyl)benzoate (PubChem CID 145124649) has the molecular formula C24H13F9O3 and a molecular weight of 520.35 g/mol. Its IUPAC name is [4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl] 4-(4,4-difluorobut-3-enyl)benzoate.
| Compound Name | [4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl] 4-(4,4-difluorobut-3-enyl)benzoate |
|---|---|
| PubChem CID | 145124649 |
| Molecular Formula | C24H13F9O3 |
| Molecular Weight | 520.35 g/mol |
| Exact Mass | 520.07 |
| IUPAC Name | [4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl] 4-(4,4-difluorobut-3-enyl)benzoate |
| SMILES | O=C(Oc1cc(F)c(C(F)(F)Oc2cc(F)c(F)c(F)c2)c(F)c1)c1ccc(CCC=C(F)F)cc1 |
| InChI | InChI=1S/C24H13F9O3/c25-16-8-14(35-23(34)13-6-4-12(5-7-13)2-1-3-20(29)30)9-17(26)21(16)24(32,33)36-15-10-18(27)22(31)19(28)11-15/h3-11H,1-2H2 |
| InChIKey | LHDDTSWNBHHXBK-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.35 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|