C34H28F6O3 — CID 135235097
(3,4,5-trifluorophenyl) 4-[7-[4-[2-(3,4,5-trifluorophenyl)acetyl]phenyl]heptyl]benzoate (PubChem CID 135235097) has the molecular formula C34H28F6O3 and a molecular weight of 598.58 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl) 4-[7-[4-[2-(3,4,5-trifluorophenyl)acetyl]phenyl]heptyl]benzoate.
| Compound Name | (3,4,5-trifluorophenyl) 4-[7-[4-[2-(3,4,5-trifluorophenyl)acetyl]phenyl]heptyl]benzoate |
|---|---|
| PubChem CID | 135235097 |
| Molecular Formula | C34H28F6O3 |
| Molecular Weight | 598.58 g/mol |
| Exact Mass | 598.19 |
| IUPAC Name | (3,4,5-trifluorophenyl) 4-[7-[4-[2-(3,4,5-trifluorophenyl)acetyl]phenyl]heptyl]benzoate |
| SMILES | O=C(Cc1cc(F)c(F)c(F)c1)c1ccc(CCCCCCCc2ccc(C(=O)Oc3cc(F)c(F)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C34H28F6O3/c35-27-16-23(17-28(36)32(27)39)18-31(41)24-12-8-21(9-13-24)6-4-2-1-3-5-7-22-10-14-25(15-11-22)34(42)43-26-19-29(37)33(40)30(38)20-26/h8-17,19-20H,1-7,18H2 |
| InChIKey | JEGQNPXCMXGHOM-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.58 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|