C28H18F6O4 — CID 145100540
(3,4,5-trifluorophenyl) 4-[[4-[(3,4,5-trifluorophenoxy)methoxymethyl]phenyl]methyl]benzoate (PubChem CID 145100540) has the molecular formula C28H18F6O4 and a molecular weight of 532.44 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl) 4-[[4-[(3,4,5-trifluorophenoxy)methoxymethyl]phenyl]methyl]benzoate.
| Compound Name | (3,4,5-trifluorophenyl) 4-[[4-[(3,4,5-trifluorophenoxy)methoxymethyl]phenyl]methyl]benzoate |
|---|---|
| PubChem CID | 145100540 |
| Molecular Formula | C28H18F6O4 |
| Molecular Weight | 532.44 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | (3,4,5-trifluorophenyl) 4-[[4-[(3,4,5-trifluorophenoxy)methoxymethyl]phenyl]methyl]benzoate |
| SMILES | O=C(Oc1cc(F)c(F)c(F)c1)c1ccc(Cc2ccc(COCOc3cc(F)c(F)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C28H18F6O4/c29-22-10-20(11-23(30)26(22)33)37-15-36-14-18-3-1-16(2-4-18)9-17-5-7-19(8-6-17)28(35)38-21-12-24(31)27(34)25(32)13-21/h1-8,10-13H,9,14-15H2 |
| InChIKey | JHTFCYRIQOHESP-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.44 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|