C34H21F3O7 — CID 142737532
(3,4,5-trifluorophenyl) 3-[4-(4-phenylmethoxybenzoyl)oxybenzoyl]oxybenzoate (PubChem CID 142737532) has the molecular formula C34H21F3O7 and a molecular weight of 598.53 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl) 3-[4-(4-phenylmethoxybenzoyl)oxybenzoyl]oxybenzoate.
| Compound Name | (3,4,5-trifluorophenyl) 3-[4-(4-phenylmethoxybenzoyl)oxybenzoyl]oxybenzoate |
|---|---|
| PubChem CID | 142737532 |
| Molecular Formula | C34H21F3O7 |
| Molecular Weight | 598.53 g/mol |
| Exact Mass | 598.12 |
| IUPAC Name | (3,4,5-trifluorophenyl) 3-[4-(4-phenylmethoxybenzoyl)oxybenzoyl]oxybenzoate |
| SMILES | O=C(Oc1ccc(C(=O)Oc2cccc(C(=O)Oc3cc(F)c(F)c(F)c3)c2)cc1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C34H21F3O7/c35-29-18-28(19-30(36)31(29)37)44-34(40)24-7-4-8-27(17-24)43-33(39)23-11-15-26(16-12-23)42-32(38)22-9-13-25(14-10-22)41-20-21-5-2-1-3-6-21/h1-19H,20H2 |
| InChIKey | INITUCBHPGKJOZ-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.53 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|