C20H14F2O3 — CID 91699651
(4-phenylmethoxyphenyl) 2,5-difluorobenzoate (PubChem CID 91699651) has the molecular formula C20H14F2O3 and a molecular weight of 340.33 g/mol. Its IUPAC name is (4-phenylmethoxyphenyl) 2,5-difluorobenzoate.
| Compound Name | (4-phenylmethoxyphenyl) 2,5-difluorobenzoate |
|---|---|
| PubChem CID | 91699651 |
| Molecular Formula | C20H14F2O3 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | (4-phenylmethoxyphenyl) 2,5-difluorobenzoate |
| SMILES | O=C(Oc1ccc(OCc2ccccc2)cc1)c1cc(F)ccc1F |
| InChI | InChI=1S/C20H14F2O3/c21-15-6-11-19(22)18(12-15)20(23)25-17-9-7-16(8-10-17)24-13-14-4-2-1-3-5-14/h1-12H,13H2 |
| InChIKey | RYZWKDFCBSDLHU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|