C29H22N2O3 — CID 3630951
(4-phenylmethoxyphenyl) 1,3-diphenylpyrazole-4-carboxylate (PubChem CID 3630951) has the molecular formula C29H22N2O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is (4-phenylmethoxyphenyl) 1,3-diphenylpyrazole-4-carboxylate.
| Compound Name | (4-phenylmethoxyphenyl) 1,3-diphenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 3630951 |
| Molecular Formula | C29H22N2O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | (4-phenylmethoxyphenyl) 1,3-diphenylpyrazole-4-carboxylate |
| SMILES | O=C(Oc1ccc(OCc2ccccc2)cc1)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C29H22N2O3/c32-29(34-26-18-16-25(17-19-26)33-21-22-10-4-1-5-11-22)27-20-31(24-14-8-3-9-15-24)30-28(27)23-12-6-2-7-13-23/h1-20H,21H2 |
| InChIKey | QTSPAXVSALHRIL-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|