C25H17N3O4 — CID 3882566
(1,3-dioxoisoindol-2-yl)methyl 1,3-diphenylpyrazole-4-carboxylate (PubChem CID 3882566) has the molecular formula C25H17N3O4 and a molecular weight of 423.43 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 1,3-diphenylpyrazole-4-carboxylate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 1,3-diphenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 3882566 |
| Molecular Formula | C25H17N3O4 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 1,3-diphenylpyrazole-4-carboxylate |
| SMILES | O=C(OCN1C(=O)c2ccccc2C1=O)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C25H17N3O4/c29-23-19-13-7-8-14-20(19)24(30)27(23)16-32-25(31)21-15-28(18-11-5-2-6-12-18)26-22(21)17-9-3-1-4-10-17/h1-15H,16H2 |
| InChIKey | MKGFPFLAVHCXHT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|