C18H14N2O2 — CID 69067763
2-(1,3-diphenylpyrazol-4-yl)prop-2-enoic acid (PubChem CID 69067763) has the molecular formula C18H14N2O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-(1,3-diphenylpyrazol-4-yl)prop-2-enoic acid.
| Compound Name | 2-(1,3-diphenylpyrazol-4-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 69067763 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-(1,3-diphenylpyrazol-4-yl)prop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C18H14N2O2/c1-13(18(21)22)16-12-20(15-10-6-3-7-11-15)19-17(16)14-8-4-2-5-9-14/h2-12H,1H2,(H,21,22) |
| InChIKey | YDWKVVFBMWFGEH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|