2-(1,3-diphenylpyrazol-4-yl)prop-2-enoic acid

C18H14N2O2 — CID 69067763

IUPAC2-(1,3-diphenylpyrazol-4-yl)prop-2-enoic acid
SMILESC=C(C(=O)O)c1cn(-c2ccccc2)nc1-c1ccccc1
InChIInChI=1S/C18H14N2O2/c1-13(18(21)22)16-12-20(15-10-6-3-7-11-15)19-17(16)14-8-4-2-5-9-14/h2-12H,1H2,(H,21,22)
InChIKeyYDWKVVFBMWFGEH-UHFFFAOYSA-N
MW290.32 g/mol
LogP3.64
Rot. Bonds4

About 2-(1,3-diphenylpyrazol-4-yl)prop-2-enoic acid

2-(1,3-diphenylpyrazol-4-yl)prop-2-enoic acid (PubChem CID 69067763) has the molecular formula C18H14N2O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-(1,3-diphenylpyrazol-4-yl)prop-2-enoic acid.

Molecular Properties

Compound Name2-(1,3-diphenylpyrazol-4-yl)prop-2-enoic acid
PubChem CID69067763
Molecular FormulaC18H14N2O2
Molecular Weight290.32 g/mol
Exact Mass290.11
IUPAC Name2-(1,3-diphenylpyrazol-4-yl)prop-2-enoic acid
SMILESC=C(C(=O)O)c1cn(-c2ccccc2)nc1-c1ccccc1
InChIInChI=1S/C18H14N2O2/c1-13(18(21)22)16-12-20(15-10-6-3-7-11-15)19-17(16)14-8-4-2-5-9-14/h2-12H,1H2,(H,21,22)
InChIKeyYDWKVVFBMWFGEH-UHFFFAOYSA-N
XLogP3.64
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.32
LogP ≤ 53.64
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-(1,3-diphenylpyrazol-4-yl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,3-diphenylpyrazol-4-yl)prop-2-enoic acid?
The IUPAC name of 2-(1,3-diphenylpyrazol-4-yl)prop-2-enoic acid (CID 69067763) is 2-(1,3-diphenylpyrazol-4-yl)prop-2-enoic acid.
What is the SMILES notation for 2-(1,3-diphenylpyrazol-4-yl)prop-2-enoic acid?
The canonical SMILES for 2-(1,3-diphenylpyrazol-4-yl)prop-2-enoic acid is C=C(C(=O)O)c1cn(-c2ccccc2)nc1-c1ccccc1.
What is the InChIKey of 2-(1,3-diphenylpyrazol-4-yl)prop-2-enoic acid?
The InChIKey is YDWKVVFBMWFGEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O2/c1-13(18(21)22)16-12-20(15-10-6-3-7-11-15)19-17(16)14-8-4-2-5-9-14/h2-12H,1H2,(H,21,22).
What are the key properties of 2-(1,3-diphenylpyrazol-4-yl)prop-2-enoic acid?
2-(1,3-diphenylpyrazol-4-yl)prop-2-enoic acid has a molecular weight of 290.32 g/mol, XLogP of 3.64, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-diphenylpyrazol-4-yl)prop-2-enoic acid is sourced from PubChem (CID 69067763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).