C22H15N5O — CID 1409855
benzotriazol-1-yl-(1,3-diphenylpyrazol-4-yl)methanone (PubChem CID 1409855) has the molecular formula C22H15N5O and a molecular weight of 365.40 g/mol. Its IUPAC name is benzotriazol-1-yl-(1,3-diphenylpyrazol-4-yl)methanone.
| Compound Name | benzotriazol-1-yl-(1,3-diphenylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 1409855 |
| Molecular Formula | C22H15N5O |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | benzotriazol-1-yl-(1,3-diphenylpyrazol-4-yl)methanone |
| SMILES | O=C(c1cn(-c2ccccc2)nc1-c1ccccc1)n1nnc2ccccc21 |
| InChI | InChI=1S/C22H15N5O/c28-22(27-20-14-8-7-13-19(20)23-25-27)18-15-26(17-11-5-2-6-12-17)24-21(18)16-9-3-1-4-10-16/h1-15H |
| InChIKey | CYQKPQNCLCVFKT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |