C28H23NO6S — CID 11123962
[4-(4-phenylmethoxyphenyl)sulfonylphenyl] 3-(methylcarbamoyl)benzoate (PubChem CID 11123962) has the molecular formula C28H23NO6S and a molecular weight of 501.56 g/mol. Its IUPAC name is [4-(4-phenylmethoxyphenyl)sulfonylphenyl] 3-(methylcarbamoyl)benzoate.
| Compound Name | [4-(4-phenylmethoxyphenyl)sulfonylphenyl] 3-(methylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 11123962 |
| Molecular Formula | C28H23NO6S |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | [4-(4-phenylmethoxyphenyl)sulfonylphenyl] 3-(methylcarbamoyl)benzoate |
| SMILES | CNC(=O)c1cccc(C(=O)Oc2ccc(S(=O)(=O)c3ccc(OCc4ccccc4)cc3)cc2)c1 |
| InChI | InChI=1S/C28H23NO6S/c1-29-27(30)21-8-5-9-22(18-21)28(31)35-24-12-16-26(17-13-24)36(32,33)25-14-10-23(11-15-25)34-19-20-6-3-2-4-7-20/h2-18H,19H2,1H3,(H,29,30) |
| InChIKey | FAZGUZMSYPPQIV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|