C28H33F3O3 — CID 54127263
(3,4,5-trifluorophenyl) 4-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]benzoate (PubChem CID 54127263) has the molecular formula C28H33F3O3 and a molecular weight of 474.56 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl) 4-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]benzoate.
| Compound Name | (3,4,5-trifluorophenyl) 4-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]benzoate |
|---|---|
| PubChem CID | 54127263 |
| Molecular Formula | C28H33F3O3 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | (3,4,5-trifluorophenyl) 4-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]benzoate |
| SMILES | CCC1CCC(C2CCC(COc3ccc(C(=O)Oc4cc(F)c(F)c(F)c4)cc3)CC2)CC1 |
| InChI | InChI=1S/C28H33F3O3/c1-2-18-3-7-20(8-4-18)21-9-5-19(6-10-21)17-33-23-13-11-22(12-14-23)28(32)34-24-15-25(29)27(31)26(30)16-24/h11-16,18-21H,2-10,17H2,1H3 |
| InChIKey | NRVWTQPNVJGJGY-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|