C20H22O5 — CID 89467653
(4-hydroxyphenyl) 4-[(4-hydroxycyclohexyl)methoxy]benzoate (PubChem CID 89467653) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is (4-hydroxyphenyl) 4-[(4-hydroxycyclohexyl)methoxy]benzoate.
| Compound Name | (4-hydroxyphenyl) 4-[(4-hydroxycyclohexyl)methoxy]benzoate |
|---|---|
| PubChem CID | 89467653 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (4-hydroxyphenyl) 4-[(4-hydroxycyclohexyl)methoxy]benzoate |
| SMILES | O=C(Oc1ccc(O)cc1)c1ccc(OCC2CCC(O)CC2)cc1 |
| InChI | InChI=1S/C20H22O5/c21-16-5-1-14(2-6-16)13-24-18-9-3-15(4-10-18)20(23)25-19-11-7-17(22)8-12-19/h3-4,7-12,14,16,21-22H,1-2,5-6,13H2 |
| InChIKey | VOFFJIPEWIRXII-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|