C27H34O7 — CID 88957994
[4-[1-(oxiran-2-ylmethoxy)butoxy]phenyl] 4-[(4-hydroxycyclohexyl)methoxy]benzoate (PubChem CID 88957994) has the molecular formula C27H34O7 and a molecular weight of 470.56 g/mol. Its IUPAC name is [4-[1-(oxiran-2-ylmethoxy)butoxy]phenyl] 4-[(4-hydroxycyclohexyl)methoxy]benzoate.
| Compound Name | [4-[1-(oxiran-2-ylmethoxy)butoxy]phenyl] 4-[(4-hydroxycyclohexyl)methoxy]benzoate |
|---|---|
| PubChem CID | 88957994 |
| Molecular Formula | C27H34O7 |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | [4-[1-(oxiran-2-ylmethoxy)butoxy]phenyl] 4-[(4-hydroxycyclohexyl)methoxy]benzoate |
| SMILES | CCCC(OCC1CO1)Oc1ccc(OC(=O)c2ccc(OCC3CCC(O)CC3)cc2)cc1 |
| InChI | InChI=1S/C27H34O7/c1-2-3-26(32-18-25-17-31-25)33-23-12-14-24(15-13-23)34-27(29)20-6-10-22(11-7-20)30-16-19-4-8-21(28)9-5-19/h6-7,10-15,19,21,25-26,28H,2-5,8-9,16-18H2,1H3 |
| InChIKey | FXBLUMOSJZWXDB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|