C41H51FO8 — CID 88957934
[4-[4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]phenyl]phenyl] 2-fluoro-4-[1-[(4-hydroxycyclohexyl)methoxy]butoxy]benzoate (PubChem CID 88957934) has the molecular formula C41H51FO8 and a molecular weight of 690.85 g/mol. Its IUPAC name is [4-[4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]phenyl]phenyl] 2-fluoro-4-[1-[(4-hydroxycyclohexyl)methoxy]butoxy]benzoate.
| Compound Name | [4-[4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]phenyl]phenyl] 2-fluoro-4-[1-[(4-hydroxycyclohexyl)methoxy]butoxy]benzoate |
|---|---|
| PubChem CID | 88957934 |
| Molecular Formula | C41H51FO8 |
| Molecular Weight | 690.85 g/mol |
| Exact Mass | 690.36 |
| IUPAC Name | [4-[4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]phenyl]phenyl] 2-fluoro-4-[1-[(4-hydroxycyclohexyl)methoxy]butoxy]benzoate |
| SMILES | CCCC(OCC1CCC(O)CC1)Oc1ccc(C(=O)Oc2ccc(-c3ccc(OC(CCC)OCC4CCC5OC5C4)cc3)cc2)c(F)c1 |
| InChI | InChI=1S/C41H51FO8/c1-3-5-39(46-26-28-9-22-37-38(23-28)50-37)47-32-16-10-29(11-17-32)30-12-18-33(19-13-30)49-41(44)35-21-20-34(24-36(35)42)48-40(6-4-2)45-25-27-7-14-31(43)15-8-27/h10-13,16-21,24,27-28,31,37-40,43H,3-9,14-15,22-23,25-26H2,1-2H3 |
| InChIKey | YDMYIZNKQDHTJO-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.85 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|