C22H22F4O4 — CID 122500536
(3,4,5-trifluorophenyl) 2-fluoro-4-[5-(propoxymethyl)oxan-2-yl]benzoate (PubChem CID 122500536) has the molecular formula C22H22F4O4 and a molecular weight of 426.41 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl) 2-fluoro-4-[5-(propoxymethyl)oxan-2-yl]benzoate.
| Compound Name | (3,4,5-trifluorophenyl) 2-fluoro-4-[5-(propoxymethyl)oxan-2-yl]benzoate |
|---|---|
| PubChem CID | 122500536 |
| Molecular Formula | C22H22F4O4 |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | (3,4,5-trifluorophenyl) 2-fluoro-4-[5-(propoxymethyl)oxan-2-yl]benzoate |
| SMILES | CCCOCC1CCC(c2ccc(C(=O)Oc3cc(F)c(F)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C22H22F4O4/c1-2-7-28-11-13-3-6-20(29-12-13)14-4-5-16(17(23)8-14)22(27)30-15-9-18(24)21(26)19(25)10-15/h4-5,8-10,13,20H,2-3,6-7,11-12H2,1H3 |
| InChIKey | MAYFPCSMTMECEZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|