C34H27F9O3 — CID 122500556
2-[4-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-(propoxymethyl)oxane (PubChem CID 122500556) has the molecular formula C34H27F9O3 and a molecular weight of 654.57 g/mol. Its IUPAC name is 2-[4-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-(propoxymethyl)oxane.
| Compound Name | 2-[4-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-(propoxymethyl)oxane |
|---|---|
| PubChem CID | 122500556 |
| Molecular Formula | C34H27F9O3 |
| Molecular Weight | 654.57 g/mol |
| Exact Mass | 654.18 |
| IUPAC Name | 2-[4-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-(propoxymethyl)oxane |
| SMILES | CCCOCC1CCC(c2ccc(-c3cc(F)c(C(F)(F)Oc4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C34H27F9O3/c1-2-9-44-16-18-3-8-31(45-17-18)19-4-6-23(25(35)10-19)20-11-27(37)32(28(38)12-20)34(42,43)46-22-5-7-24(26(36)15-22)21-13-29(39)33(41)30(40)14-21/h4-7,10-15,18,31H,2-3,8-9,16-17H2,1H3 |
| InChIKey | WJHHDJCNBCRXJL-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.57 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|