C34H28F6O4 — CID 122500565
[4-(3,4-difluorophenyl)-3-fluorophenyl] 2,6-difluoro-4-[2-fluoro-4-[5-(propoxymethyl)oxan-2-yl]phenyl]benzoate (PubChem CID 122500565) has the molecular formula C34H28F6O4 and a molecular weight of 614.58 g/mol. Its IUPAC name is [4-(3,4-difluorophenyl)-3-fluorophenyl] 2,6-difluoro-4-[2-fluoro-4-[5-(propoxymethyl)oxan-2-yl]phenyl]benzoate.
| Compound Name | [4-(3,4-difluorophenyl)-3-fluorophenyl] 2,6-difluoro-4-[2-fluoro-4-[5-(propoxymethyl)oxan-2-yl]phenyl]benzoate |
|---|---|
| PubChem CID | 122500565 |
| Molecular Formula | C34H28F6O4 |
| Molecular Weight | 614.58 g/mol |
| Exact Mass | 614.19 |
| IUPAC Name | [4-(3,4-difluorophenyl)-3-fluorophenyl] 2,6-difluoro-4-[2-fluoro-4-[5-(propoxymethyl)oxan-2-yl]phenyl]benzoate |
| SMILES | CCCOCC1CCC(c2ccc(-c3cc(F)c(C(=O)Oc4ccc(-c5ccc(F)c(F)c5)c(F)c4)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C34H28F6O4/c1-2-11-42-17-19-3-10-32(43-18-19)21-4-7-25(27(36)13-21)22-14-30(39)33(31(40)15-22)34(41)44-23-6-8-24(28(37)16-23)20-5-9-26(35)29(38)12-20/h4-9,12-16,19,32H,2-3,10-11,17-18H2,1H3 |
| InChIKey | MMXFCQPPZHYYEB-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.58 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|