C30H29F2NO3 — CID 18913757
[4-(4-cyano-3,5-difluorophenyl)phenyl] 4-[4-(propoxymethyl)cyclohexyl]benzoate (PubChem CID 18913757) has the molecular formula C30H29F2NO3 and a molecular weight of 489.56 g/mol. Its IUPAC name is [4-(4-cyano-3,5-difluorophenyl)phenyl] 4-[4-(propoxymethyl)cyclohexyl]benzoate.
| Compound Name | [4-(4-cyano-3,5-difluorophenyl)phenyl] 4-[4-(propoxymethyl)cyclohexyl]benzoate |
|---|---|
| PubChem CID | 18913757 |
| Molecular Formula | C30H29F2NO3 |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | [4-(4-cyano-3,5-difluorophenyl)phenyl] 4-[4-(propoxymethyl)cyclohexyl]benzoate |
| SMILES | CCCOCC1CCC(c2ccc(C(=O)Oc3ccc(-c4cc(F)c(C#N)c(F)c4)cc3)cc2)CC1 |
| InChI | InChI=1S/C30H29F2NO3/c1-2-15-35-19-20-3-5-21(6-4-20)22-7-9-24(10-8-22)30(34)36-26-13-11-23(12-14-26)25-16-28(31)27(18-33)29(32)17-25/h7-14,16-17,20-21H,2-6,15,19H2,1H3 |
| InChIKey | AOPUIFGFBQHMRP-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|