C27H30O2Si — CID 123483170
[4-(4-methylphenyl)phenyl] 4-[4-(silylmethyl)cyclohexyl]benzoate (PubChem CID 123483170) has the molecular formula C27H30O2Si and a molecular weight of 414.62 g/mol. Its IUPAC name is [4-(4-methylphenyl)phenyl] 4-[4-(silylmethyl)cyclohexyl]benzoate.
| Compound Name | [4-(4-methylphenyl)phenyl] 4-[4-(silylmethyl)cyclohexyl]benzoate |
|---|---|
| PubChem CID | 123483170 |
| Molecular Formula | C27H30O2Si |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | [4-(4-methylphenyl)phenyl] 4-[4-(silylmethyl)cyclohexyl]benzoate |
| SMILES | Cc1ccc(-c2ccc(OC(=O)c3ccc(C4CCC(C[SiH3])CC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C27H30O2Si/c1-19-2-6-21(7-3-19)24-14-16-26(17-15-24)29-27(28)25-12-10-23(11-13-25)22-8-4-20(18-30)5-9-22/h2-3,6-7,10-17,20,22H,4-5,8-9,18H2,1,30H3 |
| InChIKey | DNCKOYVIKIQXSJ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|