C20H26Si — CID 123942923
[4-[4-(4-methylphenyl)phenyl]cyclohexyl]methylsilane (PubChem CID 123942923) has the molecular formula C20H26Si and a molecular weight of 294.51 g/mol. Its IUPAC name is [4-[4-(4-methylphenyl)phenyl]cyclohexyl]methylsilane.
| Compound Name | [4-[4-(4-methylphenyl)phenyl]cyclohexyl]methylsilane |
|---|---|
| PubChem CID | 123942923 |
| Molecular Formula | C20H26Si |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | [4-[4-(4-methylphenyl)phenyl]cyclohexyl]methylsilane |
| SMILES | Cc1ccc(-c2ccc(C3CCC(C[SiH3])CC3)cc2)cc1 |
| InChI | InChI=1S/C20H26Si/c1-15-2-6-17(7-3-15)19-10-12-20(13-11-19)18-8-4-16(14-21)5-9-18/h2-3,6-7,10-13,16,18H,4-5,8-9,14H2,1,21H3 |
| InChIKey | GVTBAKQLKOYVTH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|