C27H29F3OSi — CID 137329298
[4-[4-[4-[difluoro-(4-methylphenoxy)methyl]-3-fluorophenyl]phenyl]cyclohexyl]methylsilane (PubChem CID 137329298) has the molecular formula C27H29F3OSi and a molecular weight of 454.61 g/mol. Its IUPAC name is [4-[4-[4-[difluoro-(4-methylphenoxy)methyl]-3-fluorophenyl]phenyl]cyclohexyl]methylsilane.
| Compound Name | [4-[4-[4-[difluoro-(4-methylphenoxy)methyl]-3-fluorophenyl]phenyl]cyclohexyl]methylsilane |
|---|---|
| PubChem CID | 137329298 |
| Molecular Formula | C27H29F3OSi |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | [4-[4-[4-[difluoro-(4-methylphenoxy)methyl]-3-fluorophenyl]phenyl]cyclohexyl]methylsilane |
| SMILES | Cc1ccc(OC(F)(F)c2ccc(-c3ccc(C4CCC(C[SiH3])CC4)cc3)cc2F)cc1 |
| InChI | InChI=1S/C27H29F3OSi/c1-18-2-13-24(14-3-18)31-27(29,30)25-15-12-23(16-26(25)28)22-10-8-21(9-11-22)20-6-4-19(17-32)5-7-20/h2-3,8-16,19-20H,4-7,17H2,1,32H3 |
| InChIKey | STXTZXQWIRHJHN-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|