C21H24F2O2Si — CID 123759954
(4-methylphenyl) 2,6-difluoro-4-[4-(silylmethyl)cyclohexyl]benzoate (PubChem CID 123759954) has the molecular formula C21H24F2O2Si and a molecular weight of 374.50 g/mol. Its IUPAC name is (4-methylphenyl) 2,6-difluoro-4-[4-(silylmethyl)cyclohexyl]benzoate.
| Compound Name | (4-methylphenyl) 2,6-difluoro-4-[4-(silylmethyl)cyclohexyl]benzoate |
|---|---|
| PubChem CID | 123759954 |
| Molecular Formula | C21H24F2O2Si |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (4-methylphenyl) 2,6-difluoro-4-[4-(silylmethyl)cyclohexyl]benzoate |
| SMILES | Cc1ccc(OC(=O)c2c(F)cc(C3CCC(C[SiH3])CC3)cc2F)cc1 |
| InChI | InChI=1S/C21H24F2O2Si/c1-13-2-8-17(9-3-13)25-21(24)20-18(22)10-16(11-19(20)23)15-6-4-14(12-26)5-7-15/h2-3,8-11,14-15H,4-7,12H2,1,26H3 |
| InChIKey | RLGUFKSNKAORBD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|