About (3,5-difluoro-4-methylphenyl) 2,6-difluoro-4-(4-methylcyclohexyl)benzoate;methane
(3,5-difluoro-4-methylphenyl) 2,6-difluoro-4-(4-methylcyclohexyl)benzoate;methane (PubChem CID 161455344) has the molecular formula C22H24F4O2
and a molecular weight of 396.42 g/mol. Its IUPAC name is (3,5-difluoro-4-methylphenyl) 2,6-difluoro-4-(4-methylcyclohexyl)benzoate;methane.
Molecular Properties
| Compound Name | (3,5-difluoro-4-methylphenyl) 2,6-difluoro-4-(4-methylcyclohexyl)benzoate;methane |
| PubChem CID | 161455344 |
| Molecular Formula | C22H24F4O2 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | (3,5-difluoro-4-methylphenyl) 2,6-difluoro-4-(4-methylcyclohexyl)benzoate;methane |
| SMILES | C.Cc1c(F)cc(OC(=O)c2c(F)cc(C3CCC(C)CC3)cc2F)cc1F |
| InChI | InChI=1S/C21H20F4O2.CH4/c1-11-3-5-13(6-4-11)14-7-18(24)20(19(25)8-14)21(26)27-15-9-16(22)12(2)17(23)10-15;/h7-11,13H,3-6H2,1-2H3;1H4 |
| InChIKey | WBBRVFATQIVIFD-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3,5-difluoro-4-methylphenyl) 2,6-difluoro-4-(4-methylcyclohexyl)benzoate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-difluoro-4-methylphenyl) 2,6-difluoro-4-(4-methylcyclohexyl)benzoate;methane?
The IUPAC name of (3,5-difluoro-4-methylphenyl) 2,6-difluoro-4-(4-methylcyclohexyl)benzoate;methane (CID 161455344) is (3,5-difluoro-4-methylphenyl) 2,6-difluoro-4-(4-methylcyclohexyl)benzoate;methane.
What is the SMILES notation for (3,5-difluoro-4-methylphenyl) 2,6-difluoro-4-(4-methylcyclohexyl)benzoate;methane?
The canonical SMILES for (3,5-difluoro-4-methylphenyl) 2,6-difluoro-4-(4-methylcyclohexyl)benzoate;methane is C.Cc1c(F)cc(OC(=O)c2c(F)cc(C3CCC(C)CC3)cc2F)cc1F.
What is the InChIKey of (3,5-difluoro-4-methylphenyl) 2,6-difluoro-4-(4-methylcyclohexyl)benzoate;methane?
The InChIKey is WBBRVFATQIVIFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20F4O2.CH4/c1-11-3-5-13(6-4-11)14-7-18(24)20(19(25)8-14)21(26)27-15-9-16(22)12(2)17(23)10-15;/h7-11,13H,3-6H2,1-2H3;1H4.
What are the key properties of (3,5-difluoro-4-methylphenyl) 2,6-difluoro-4-(4-methylcyclohexyl)benzoate;methane?
(3,5-difluoro-4-methylphenyl) 2,6-difluoro-4-(4-methylcyclohexyl)benzoate;methane has a molecular weight of 396.42 g/mol, XLogP of 6.70, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-difluoro-4-methylphenyl) 2,6-difluoro-4-(4-methylcyclohexyl)benzoate;methane is sourced from PubChem (CID 161455344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).