C29H32F4O2 — CID 89134831
[3,5-difluoro-4-[(E)-prop-1-enyl]phenyl] 2,6-difluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]benzoate (PubChem CID 89134831) has the molecular formula C29H32F4O2 and a molecular weight of 488.57 g/mol. Its IUPAC name is [3,5-difluoro-4-[(E)-prop-1-enyl]phenyl] 2,6-difluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]benzoate.
| Compound Name | [3,5-difluoro-4-[(E)-prop-1-enyl]phenyl] 2,6-difluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]benzoate |
|---|---|
| PubChem CID | 89134831 |
| Molecular Formula | C29H32F4O2 |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | [3,5-difluoro-4-[(E)-prop-1-enyl]phenyl] 2,6-difluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]benzoate |
| SMILES | C/C=C/c1c(F)cc(OC(=O)c2c(F)cc(C3CCC(C4CCC(C)CC4)CC3)cc2F)cc1F |
| InChI | InChI=1S/C29H32F4O2/c1-3-4-23-24(30)15-22(16-25(23)31)35-29(34)28-26(32)13-21(14-27(28)33)20-11-9-19(10-12-20)18-7-5-17(2)6-8-18/h3-4,13-20H,5-12H2,1-2H3/b4-3+ |
| InChIKey | MXVQPUFTWIORCV-ONEGZZNKSA-N |
| XLogP | 8.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|