C20H20F4O2 — CID 159652850
(3,4-difluorophenyl) 2,6-difluoro-4-(4-methylcyclohexyl)benzoate;molecular hydrogen (PubChem CID 159652850) has the molecular formula C20H20F4O2 and a molecular weight of 368.37 g/mol. Its IUPAC name is (3,4-difluorophenyl) 2,6-difluoro-4-(4-methylcyclohexyl)benzoate;molecular hydrogen.
| Compound Name | (3,4-difluorophenyl) 2,6-difluoro-4-(4-methylcyclohexyl)benzoate;molecular hydrogen |
|---|---|
| PubChem CID | 159652850 |
| Molecular Formula | C20H20F4O2 |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (3,4-difluorophenyl) 2,6-difluoro-4-(4-methylcyclohexyl)benzoate;molecular hydrogen |
| SMILES | CC1CCC(c2cc(F)c(C(=O)Oc3ccc(F)c(F)c3)c(F)c2)CC1.[H][H] |
| InChI | InChI=1S/C20H18F4O2.H2/c1-11-2-4-12(5-3-11)13-8-17(23)19(18(24)9-13)20(25)26-14-6-7-15(21)16(22)10-14;/h6-12H,2-5H2,1H3;1H |
| InChIKey | MRUIMAHUSXQORB-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|