C21H19F4O2Si — CID 20632264
CID 20632264 (PubChem CID 20632264) has the molecular formula C21H19F4O2Si and a molecular weight of 407.46 g/mol.
| Compound Name | CID 20632264 |
|---|---|
| PubChem CID | 20632264 |
| Molecular Formula | C21H19F4O2Si |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | — |
| SMILES | Cc1c(F)cc(OC(=O)c2c(F)cc(C3CCC(C[Si])CC3)cc2F)cc1F |
| InChI | InChI=1S/C21H19F4O2Si/c1-11-16(22)8-15(9-17(11)23)27-21(26)20-18(24)6-14(7-19(20)25)13-4-2-12(10-28)3-5-13/h6-9,12-13H,2-5,10H2,1H3 |
| InChIKey | QLFNZXPGHBVPKY-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|