C28H34O2 — CID 139868258
(4-methylphenyl) 4-(6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate (PubChem CID 139868258) has the molecular formula C28H34O2 and a molecular weight of 402.58 g/mol. Its IUPAC name is (4-methylphenyl) 4-(6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate.
| Compound Name | (4-methylphenyl) 4-(6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate |
|---|---|
| PubChem CID | 139868258 |
| Molecular Formula | C28H34O2 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | (4-methylphenyl) 4-(6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate |
| SMILES | C=CCCC1CCC2CC(c3ccc(C(=O)Oc4ccc(C)cc4)cc3)CCC2C1 |
| InChI | InChI=1S/C28H34O2/c1-3-4-5-21-8-9-26-19-25(15-14-24(26)18-21)22-10-12-23(13-11-22)28(29)30-27-16-6-20(2)7-17-27/h3,6-7,10-13,16-17,21,24-26H,1,4-5,8-9,14-15,18-19H2,2H3 |
| InChIKey | UGLOSQRBIJYAJS-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|