C28H32F2O2 — CID 139866590
(2,3-difluoro-4-methylphenyl) 4-(6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate (PubChem CID 139866590) has the molecular formula C28H32F2O2 and a molecular weight of 438.56 g/mol. Its IUPAC name is (2,3-difluoro-4-methylphenyl) 4-(6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate.
| Compound Name | (2,3-difluoro-4-methylphenyl) 4-(6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate |
|---|---|
| PubChem CID | 139866590 |
| Molecular Formula | C28H32F2O2 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | (2,3-difluoro-4-methylphenyl) 4-(6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate |
| SMILES | C=CCCC1CCC2CC(c3ccc(C(=O)Oc4ccc(C)c(F)c4F)cc3)CCC2C1 |
| InChI | InChI=1S/C28H32F2O2/c1-3-4-5-19-7-8-24-17-23(14-13-22(24)16-19)20-9-11-21(12-10-20)28(31)32-25-15-6-18(2)26(29)27(25)30/h3,6,9-12,15,19,22-24H,1,4-5,7-8,13-14,16-17H2,2H3 |
| InChIKey | HGUNRWVUTIIDHF-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|