C21H20F4O5 — CID 122500759
(3,4,5-trifluorophenyl) 2-fluoro-4-[5-(propoxymethyl)-1,3-dioxan-2-yl]benzoate (PubChem CID 122500759) has the molecular formula C21H20F4O5 and a molecular weight of 428.38 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl) 2-fluoro-4-[5-(propoxymethyl)-1,3-dioxan-2-yl]benzoate.
| Compound Name | (3,4,5-trifluorophenyl) 2-fluoro-4-[5-(propoxymethyl)-1,3-dioxan-2-yl]benzoate |
|---|---|
| PubChem CID | 122500759 |
| Molecular Formula | C21H20F4O5 |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | (3,4,5-trifluorophenyl) 2-fluoro-4-[5-(propoxymethyl)-1,3-dioxan-2-yl]benzoate |
| SMILES | CCCOCC1COC(c2ccc(C(=O)Oc3cc(F)c(F)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C21H20F4O5/c1-2-5-27-9-12-10-28-21(29-11-12)13-3-4-15(16(22)6-13)20(26)30-14-7-17(23)19(25)18(24)8-14/h3-4,6-8,12,21H,2,5,9-11H2,1H3 |
| InChIKey | PRHCCVQJZPVZBP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|