C29H28F2O4 — CID 90179529
[4-[3,5-difluoro-4-(oxiran-2-yl)phenyl]phenyl] 4-(5-propyloxan-2-yl)benzoate (PubChem CID 90179529) has the molecular formula C29H28F2O4 and a molecular weight of 478.54 g/mol. Its IUPAC name is [4-[3,5-difluoro-4-(oxiran-2-yl)phenyl]phenyl] 4-(5-propyloxan-2-yl)benzoate.
| Compound Name | [4-[3,5-difluoro-4-(oxiran-2-yl)phenyl]phenyl] 4-(5-propyloxan-2-yl)benzoate |
|---|---|
| PubChem CID | 90179529 |
| Molecular Formula | C29H28F2O4 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | [4-[3,5-difluoro-4-(oxiran-2-yl)phenyl]phenyl] 4-(5-propyloxan-2-yl)benzoate |
| SMILES | CCCC1CCC(c2ccc(C(=O)Oc3ccc(-c4cc(F)c(C5CO5)c(F)c4)cc3)cc2)OC1 |
| InChI | InChI=1S/C29H28F2O4/c1-2-3-18-4-13-26(33-16-18)20-5-7-21(8-6-20)29(32)35-23-11-9-19(10-12-23)22-14-24(30)28(25(31)15-22)27-17-34-27/h5-12,14-15,18,26-27H,2-4,13,16-17H2,1H3 |
| InChIKey | GLWBJKMPELBSMM-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|