C30H29F5O4 — CID 122500610
[4-(3,4-difluorophenyl)-3-fluorophenyl] 4-[5-(2-butoxyethyl)oxan-2-yl]-2,6-difluorobenzoate (PubChem CID 122500610) has the molecular formula C30H29F5O4 and a molecular weight of 548.55 g/mol. Its IUPAC name is [4-(3,4-difluorophenyl)-3-fluorophenyl] 4-[5-(2-butoxyethyl)oxan-2-yl]-2,6-difluorobenzoate.
| Compound Name | [4-(3,4-difluorophenyl)-3-fluorophenyl] 4-[5-(2-butoxyethyl)oxan-2-yl]-2,6-difluorobenzoate |
|---|---|
| PubChem CID | 122500610 |
| Molecular Formula | C30H29F5O4 |
| Molecular Weight | 548.55 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | [4-(3,4-difluorophenyl)-3-fluorophenyl] 4-[5-(2-butoxyethyl)oxan-2-yl]-2,6-difluorobenzoate |
| SMILES | CCCCOCCC1CCC(c2cc(F)c(C(=O)Oc3ccc(-c4ccc(F)c(F)c4)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C30H29F5O4/c1-2-3-11-37-12-10-18-4-9-28(38-17-18)20-14-26(34)29(27(35)15-20)30(36)39-21-6-7-22(24(32)16-21)19-5-8-23(31)25(33)13-19/h5-8,13-16,18,28H,2-4,9-12,17H2,1H3 |
| InChIKey | FNLANJROGWINHW-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.55 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|