C35H29ClF6O5 — CID 122500779
[3-chloro-4-(3,4,5-trifluorophenyl)phenyl] 4-[4-[5-(2-butoxyethyl)-1,3-dioxan-2-yl]-2-fluorophenyl]-2,6-difluorobenzoate (PubChem CID 122500779) has the molecular formula C35H29ClF6O5 and a molecular weight of 679.05 g/mol. Its IUPAC name is [3-chloro-4-(3,4,5-trifluorophenyl)phenyl] 4-[4-[5-(2-butoxyethyl)-1,3-dioxan-2-yl]-2-fluorophenyl]-2,6-difluorobenzoate.
| Compound Name | [3-chloro-4-(3,4,5-trifluorophenyl)phenyl] 4-[4-[5-(2-butoxyethyl)-1,3-dioxan-2-yl]-2-fluorophenyl]-2,6-difluorobenzoate |
|---|---|
| PubChem CID | 122500779 |
| Molecular Formula | C35H29ClF6O5 |
| Molecular Weight | 679.05 g/mol |
| Exact Mass | 678.16 |
| IUPAC Name | [3-chloro-4-(3,4,5-trifluorophenyl)phenyl] 4-[4-[5-(2-butoxyethyl)-1,3-dioxan-2-yl]-2-fluorophenyl]-2,6-difluorobenzoate |
| SMILES | CCCCOCCC1COC(c2ccc(-c3cc(F)c(C(=O)Oc4ccc(-c5cc(F)c(F)c(F)c5)c(Cl)c4)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C35H29ClF6O5/c1-2-3-9-44-10-8-19-17-45-35(46-18-19)20-4-6-25(27(37)11-20)22-12-28(38)32(29(39)13-22)34(43)47-23-5-7-24(26(36)16-23)21-14-30(40)33(42)31(41)15-21/h4-7,11-16,19,35H,2-3,8-10,17-18H2,1H3 |
| InChIKey | WIBYBZLRLOJCHW-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.05 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|