C26H24F4O3 — CID 122500762
5-(2-ethoxyethyl)-2-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenyl]-1,3-dioxane (PubChem CID 122500762) has the molecular formula C26H24F4O3 and a molecular weight of 460.47 g/mol. Its IUPAC name is 5-(2-ethoxyethyl)-2-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenyl]-1,3-dioxane.
| Compound Name | 5-(2-ethoxyethyl)-2-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 122500762 |
| Molecular Formula | C26H24F4O3 |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 5-(2-ethoxyethyl)-2-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenyl]-1,3-dioxane |
| SMILES | CCOCCC1COC(c2ccc(-c3ccc(-c4cc(F)c(F)c(F)c4)c(F)c3)cc2)OC1 |
| InChI | InChI=1S/C26H24F4O3/c1-2-31-10-9-16-14-32-26(33-15-16)18-5-3-17(4-6-18)19-7-8-21(22(27)11-19)20-12-23(28)25(30)24(29)13-20/h3-8,11-13,16,26H,2,9-10,14-15H2,1H3 |
| InChIKey | NARVGHHOJFAMRX-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|