C27H25ClF4O2S — CID 122500830
5-(butoxymethyl)-2-[4-[3-chloro-4-(3,4,5-trifluorophenyl)phenyl]-3-fluorophenyl]-1,3-oxathiane (PubChem CID 122500830) has the molecular formula C27H25ClF4O2S and a molecular weight of 525.01 g/mol. Its IUPAC name is 5-(butoxymethyl)-2-[4-[3-chloro-4-(3,4,5-trifluorophenyl)phenyl]-3-fluorophenyl]-1,3-oxathiane.
| Compound Name | 5-(butoxymethyl)-2-[4-[3-chloro-4-(3,4,5-trifluorophenyl)phenyl]-3-fluorophenyl]-1,3-oxathiane |
|---|---|
| PubChem CID | 122500830 |
| Molecular Formula | C27H25ClF4O2S |
| Molecular Weight | 525.01 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | 5-(butoxymethyl)-2-[4-[3-chloro-4-(3,4,5-trifluorophenyl)phenyl]-3-fluorophenyl]-1,3-oxathiane |
| SMILES | CCCCOCC1COC(c2ccc(-c3ccc(-c4cc(F)c(F)c(F)c4)c(Cl)c3)c(F)c2)SC1 |
| InChI | InChI=1S/C27H25ClF4O2S/c1-2-3-8-33-13-16-14-34-27(35-15-16)18-5-7-21(23(29)10-18)17-4-6-20(22(28)9-17)19-11-24(30)26(32)25(31)12-19/h4-7,9-12,16,27H,2-3,8,13-15H2,1H3 |
| InChIKey | IZBOLZZPSAACIG-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.01 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|