C28H24F8O2S — CID 122500733
2-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-5-(2-ethoxyethyl)thiane (PubChem CID 122500733) has the molecular formula C28H24F8O2S and a molecular weight of 576.55 g/mol. Its IUPAC name is 2-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-5-(2-ethoxyethyl)thiane.
| Compound Name | 2-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-5-(2-ethoxyethyl)thiane |
|---|---|
| PubChem CID | 122500733 |
| Molecular Formula | C28H24F8O2S |
| Molecular Weight | 576.55 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | 2-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-5-(2-ethoxyethyl)thiane |
| SMILES | CCOCCC1CCC(c2cc(F)c(C(F)(F)Oc3ccc(-c4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)SC1 |
| InChI | InChI=1S/C28H24F8O2S/c1-2-37-8-7-15-3-6-25(39-14-15)17-11-21(30)26(22(31)12-17)28(35,36)38-18-4-5-19(20(29)13-18)16-9-23(32)27(34)24(33)10-16/h4-5,9-13,15,25H,2-3,6-8,14H2,1H3 |
| InChIKey | PPLXNNCIEFHHPK-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.55 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|