C28H34F2O2 — CID 90179616
2-[4-[4-[3,5-difluoro-4-(oxiran-2-yl)phenyl]phenyl]cyclohexyl]-5-propyloxane (PubChem CID 90179616) has the molecular formula C28H34F2O2 and a molecular weight of 440.57 g/mol. Its IUPAC name is 2-[4-[4-[3,5-difluoro-4-(oxiran-2-yl)phenyl]phenyl]cyclohexyl]-5-propyloxane.
| Compound Name | 2-[4-[4-[3,5-difluoro-4-(oxiran-2-yl)phenyl]phenyl]cyclohexyl]-5-propyloxane |
|---|---|
| PubChem CID | 90179616 |
| Molecular Formula | C28H34F2O2 |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 2-[4-[4-[3,5-difluoro-4-(oxiran-2-yl)phenyl]phenyl]cyclohexyl]-5-propyloxane |
| SMILES | CCCC1CCC(C2CCC(c3ccc(-c4cc(F)c(C5CO5)c(F)c4)cc3)CC2)OC1 |
| InChI | InChI=1S/C28H34F2O2/c1-2-3-18-4-13-26(31-16-18)22-11-9-20(10-12-22)19-5-7-21(8-6-19)23-14-24(29)28(25(30)15-23)27-17-32-27/h5-8,14-15,18,20,22,26-27H,2-4,9-13,16-17H2,1H3 |
| InChIKey | KLCSWXHGRNVOHG-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|