C23H24F4O — CID 22443443
2-(2,2-difluoroethenoxy)-1,3-difluoro-5-[4-(4-propylcyclohexyl)phenyl]benzene (PubChem CID 22443443) has the molecular formula C23H24F4O and a molecular weight of 392.44 g/mol. Its IUPAC name is 2-(2,2-difluoroethenoxy)-1,3-difluoro-5-[4-(4-propylcyclohexyl)phenyl]benzene.
| Compound Name | 2-(2,2-difluoroethenoxy)-1,3-difluoro-5-[4-(4-propylcyclohexyl)phenyl]benzene |
|---|---|
| PubChem CID | 22443443 |
| Molecular Formula | C23H24F4O |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-(2,2-difluoroethenoxy)-1,3-difluoro-5-[4-(4-propylcyclohexyl)phenyl]benzene |
| SMILES | CCCC1CCC(c2ccc(-c3cc(F)c(OC=C(F)F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C23H24F4O/c1-2-3-15-4-6-16(7-5-15)17-8-10-18(11-9-17)19-12-20(24)23(21(25)13-19)28-14-22(26)27/h8-16H,2-7H2,1H3 |
| InChIKey | AJIMCTRTWVLOOI-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|