C24H24F6O — CID 90293858
1,3-difluoro-5-[2-fluoro-4-(4-propylcyclohexyl)phenyl]-2-[(E)-3,3,3-trifluoroprop-1-enoxy]benzene (PubChem CID 90293858) has the molecular formula C24H24F6O and a molecular weight of 442.44 g/mol. Its IUPAC name is 1,3-difluoro-5-[2-fluoro-4-(4-propylcyclohexyl)phenyl]-2-[(E)-3,3,3-trifluoroprop-1-enoxy]benzene.
| Compound Name | 1,3-difluoro-5-[2-fluoro-4-(4-propylcyclohexyl)phenyl]-2-[(E)-3,3,3-trifluoroprop-1-enoxy]benzene |
|---|---|
| PubChem CID | 90293858 |
| Molecular Formula | C24H24F6O |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 1,3-difluoro-5-[2-fluoro-4-(4-propylcyclohexyl)phenyl]-2-[(E)-3,3,3-trifluoroprop-1-enoxy]benzene |
| SMILES | CCCC1CCC(c2ccc(-c3cc(F)c(O/C=C/C(F)(F)F)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C24H24F6O/c1-2-3-15-4-6-16(7-5-15)17-8-9-19(20(25)12-17)18-13-21(26)23(22(27)14-18)31-11-10-24(28,29)30/h8-16H,2-7H2,1H3/b11-10+ |
| InChIKey | XIHGTPBFBASILX-ZHACJKMWSA-N |
| XLogP | 8.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|