C30H33F9 — CID 22080196
1,3-difluoro-5-[2-fluoro-4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]-2-(1,1,2,3,3,3-hexafluoropropyl)benzene (PubChem CID 22080196) has the molecular formula C30H33F9 and a molecular weight of 564.58 g/mol. Its IUPAC name is 1,3-difluoro-5-[2-fluoro-4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]-2-(1,1,2,3,3,3-hexafluoropropyl)benzene.
| Compound Name | 1,3-difluoro-5-[2-fluoro-4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]-2-(1,1,2,3,3,3-hexafluoropropyl)benzene |
|---|---|
| PubChem CID | 22080196 |
| Molecular Formula | C30H33F9 |
| Molecular Weight | 564.58 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 1,3-difluoro-5-[2-fluoro-4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]-2-(1,1,2,3,3,3-hexafluoropropyl)benzene |
| SMILES | CCCC1CCC(C2CCC(c3ccc(-c4cc(F)c(C(F)(F)C(F)C(F)(F)F)c(F)c4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C30H33F9/c1-2-3-17-4-6-18(7-5-17)19-8-10-20(11-9-19)21-12-13-23(24(31)14-21)22-15-25(32)27(26(33)16-22)29(35,36)28(34)30(37,38)39/h12-20,28H,2-11H2,1H3 |
| InChIKey | HGQZDNDEKOVZQZ-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.58 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |