C26H21F5O2 — CID 122500751
2-[4-[4-(3,4-difluorophenyl)-3,5-difluorophenyl]-3-fluorophenyl]-5-(ethenoxymethyl)oxane (PubChem CID 122500751) has the molecular formula C26H21F5O2 and a molecular weight of 460.44 g/mol. Its IUPAC name is 2-[4-[4-(3,4-difluorophenyl)-3,5-difluorophenyl]-3-fluorophenyl]-5-(ethenoxymethyl)oxane.
| Compound Name | 2-[4-[4-(3,4-difluorophenyl)-3,5-difluorophenyl]-3-fluorophenyl]-5-(ethenoxymethyl)oxane |
|---|---|
| PubChem CID | 122500751 |
| Molecular Formula | C26H21F5O2 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 2-[4-[4-(3,4-difluorophenyl)-3,5-difluorophenyl]-3-fluorophenyl]-5-(ethenoxymethyl)oxane |
| SMILES | C=COCC1CCC(c2ccc(-c3cc(F)c(-c4ccc(F)c(F)c4)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C26H21F5O2/c1-2-32-13-15-3-8-25(33-14-15)16-4-6-19(21(28)9-16)18-11-23(30)26(24(31)12-18)17-5-7-20(27)22(29)10-17/h2,4-7,9-12,15,25H,1,3,8,13-14H2 |
| InChIKey | QXEAXFRUXAVIBP-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|