C28H25F3O — CID 88998363
2-[4-[4-(2,3-difluoro-4-prop-2-enylphenyl)phenyl]-3-fluorophenyl]-5-ethenyloxane (PubChem CID 88998363) has the molecular formula C28H25F3O and a molecular weight of 434.50 g/mol. Its IUPAC name is 2-[4-[4-(2,3-difluoro-4-prop-2-enylphenyl)phenyl]-3-fluorophenyl]-5-ethenyloxane.
| Compound Name | 2-[4-[4-(2,3-difluoro-4-prop-2-enylphenyl)phenyl]-3-fluorophenyl]-5-ethenyloxane |
|---|---|
| PubChem CID | 88998363 |
| Molecular Formula | C28H25F3O |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 2-[4-[4-(2,3-difluoro-4-prop-2-enylphenyl)phenyl]-3-fluorophenyl]-5-ethenyloxane |
| SMILES | C=CCc1ccc(-c2ccc(-c3ccc(C4CCC(C=C)CO4)cc3F)cc2)c(F)c1F |
| InChI | InChI=1S/C28H25F3O/c1-3-5-21-11-14-24(28(31)27(21)30)20-9-7-19(8-10-20)23-13-12-22(16-25(23)29)26-15-6-18(4-2)17-32-26/h3-4,7-14,16,18,26H,1-2,5-6,15,17H2 |
| InChIKey | UGCSXJRVSVTLQU-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|