C31H31F3 — CID 88998095
1-[4-[4-(4-ethenylcyclohexyl)-2-fluorophenyl]phenyl]-2,3-difluoro-4-pent-4-enylbenzene (PubChem CID 88998095) has the molecular formula C31H31F3 and a molecular weight of 460.58 g/mol. Its IUPAC name is 1-[4-[4-(4-ethenylcyclohexyl)-2-fluorophenyl]phenyl]-2,3-difluoro-4-pent-4-enylbenzene.
| Compound Name | 1-[4-[4-(4-ethenylcyclohexyl)-2-fluorophenyl]phenyl]-2,3-difluoro-4-pent-4-enylbenzene |
|---|---|
| PubChem CID | 88998095 |
| Molecular Formula | C31H31F3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 1-[4-[4-(4-ethenylcyclohexyl)-2-fluorophenyl]phenyl]-2,3-difluoro-4-pent-4-enylbenzene |
| SMILES | C=CCCCc1ccc(-c2ccc(-c3ccc(C4CCC(C=C)CC4)cc3F)cc2)c(F)c1F |
| InChI | InChI=1S/C31H31F3/c1-3-5-6-7-25-16-19-28(31(34)30(25)33)24-14-12-23(13-15-24)27-18-17-26(20-29(27)32)22-10-8-21(4-2)9-11-22/h3-4,12-22H,1-2,5-11H2 |
| InChIKey | LFGIFVZUTHPXDK-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|